Systematic / IUPAC Name: (2Z)-2-{2-[(2,5-Dimethylphenoxy)methyl]phenyl}-2-(methoxyimino)-N-methylacetamide
ID: Reference3179
Other Names:
Benzeneacetamide, 2-[(2,5-dimethylphenoxy)methyl]-α-(methoxyimino)-N-methyl, (αZ)-;
(E)-2-(2,5-Dimethylphenoxymethyl)-α-methoxyimino-N-methylphenylacetamide
Formula: C19H22N2O3
Class: Pesticides/Herbicides
Dimoxystrobin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4289 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 10/26/2015 10:17:00 AM |
| InChI | InChI=1S/C19H22N2O3/c1-13-9-10-14(2)17(11-13)24-12-15-7-5-6-8-16(15)18(21-23-4)19(22)20-3/h5-11H,12H2,1-4H3,(H,20,22)/b21-18- |
| InChI Key | WXUZAHCNPWONDH-UZYVYHOESA-N |
| Canonical SMILES | CC1=CC(=C(C=C1)C)OCC2=CC=CC=C2C(=NOC)C(=O)NC |
| CAS | 149961524 |
| Splash | |
| Other Names |
Benzeneacetamide, 2-[(2,5-dimethylphenoxy)methyl]-α-(methoxyimino)-N-methyl, (αZ)-; (E)-2-(2,5-Dimethylphenoxymethyl)-α-methoxyimino-N-methylphenylacetamide |
| PubChem | 9797414 |
| ChEMBL | CHEMBL2287427 |
| Wikipedia | Dimoxystrobin (DE) |
| ChemSpider | 7973180 |