Systematic / IUPAC Name: Benzene-1,3-dicarboxylic acid
ID: Reference3201
Other Names:
m-Phthalic acid;
m-Benzenedicarboxylic acid;
m-Dicarboxybenzene;
1,3-Benzenedicarboxylic acid;
Benzene,1,3-dicarboxylic acid
Formula: C8H6O4
Class: Extractables/Leachables Industrial Chemicals Textile Chemicals/Auxiliary/Dyes
Isophthalic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 94 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | APCI |
| Analyzers | FT |
| Last Modification | 10/29/2015 12:54:02 PM |
| InChI | InChI=1S/C8H6O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H,(H,9,10)(H,11,12) |
| InChI Key | QQVIHTHCMHWDBS-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC(=C1)C(=O)O)C(=O)O |
| CAS | 121915 |
| Splash | |
| Other Names |
m-Phthalic acid; m-Benzenedicarboxylic acid; m-Dicarboxybenzene; 1,3-Benzenedicarboxylic acid; Benzene,1,3-dicarboxylic acid |