Systematic / IUPAC Name: 6-Ethoxy-2,2,4-trimethyl-1H-quinoline
ID: Reference3202
Other Names:
E 324;
Antage AW;
Dawe'S nutrigard;
Niflex;
Nix-scald
; more
Formula: C14H19NO
Class: Excipients/Additives/Colorants Pesticides/Herbicides Industrial Chemicals
Ethoxyquin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1866 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 10/29/2015 1:47:21 PM |
| InChI | InChI=1S/C14H19NO/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13/h6-9,15H,5H2,1-4H3 |
| InChI Key | DECIPOUIJURFOJ-UHFFFAOYSA-N |
| Canonical SMILES | CCOC1=CC2=C(C=C1)NC(C=C2C)(C)C |
| CAS | 91532 |
| Splash | |
| Other Names |
E 324; Antage AW; Dawe'S nutrigard; Niflex; Nix-scald; Nocrac AW; Nocrack AW; Permanax 103; Quinol ED; Santoflex A; Santoflex AW; Santoquin; Santoquine; Stop-scald; 1,2-Dihydro-2,2,4-trimethyl-6-ethoxyquinoline; 1,2-Dihydro-6-ethoxy-2,2,4-trimethylquinoline; 2,2,4-Trimethyl-6-ethoxy-1,2-dihydroquinoline; 6-(Ethyloxy)-2,2,4-trimethyl-1,2-dihydroquinoline; 6-Ethoxy-1,2-dihydro-2,2,4-trimethylquinoline; 6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline; Ethoxychin; Ethoxyquine; Ethyl 2,2,4-trimethyl-1,2-dihydro-6-quinolinyl ether; Quinoline, 6-ethoxy-1,2-dihydro-2,2,4-trimethyl-; Quinoline, 6-ethoxy-1,2-dihydro-2,2,4-trimethyl-, homopolymer |
| ChemIDPlus | 000091532; 063301917 |
| ChemSpider | 3177 |
| Wikipedia | Ethoxyquin |
| HMDb | HMDB39531 |
| ChEBI | CHEBI:77323 |
| PubChem | 3293 |