Systematic / IUPAC Name: 1-Ethoxynaphthalene
ID: Reference3205
Other Names:
α-Ethoxynaphthalene;
Ethyl α-naphthyl ether;
Ethyl 1-naphthyl ether;
Naphthalene, 1-ethoxy-
Formula: C12H12O
1-Ethoxynaphthalene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | APCI |
| Analyzers | FT |
| Last Modification | 10/29/2015 3:06:25 PM |
| InChI | InChI=1S/C12H12O/c1-2-13-12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3 |
| InChI Key | APWZAIZNWQFZBK-UHFFFAOYSA-N |
| Canonical SMILES | CCOC1=CC=CC2=CC=CC=C21 |
| CAS | 5328018 |
| Splash | |
| Other Names |
α-Ethoxynaphthalene; Ethyl α-naphthyl ether; Ethyl 1-naphthyl ether; Naphthalene, 1-ethoxy- |