Systematic / IUPAC Name: Methyl N-(2,6-dimethylphenyl)-N-2-furoylalaninate
ID: Reference3229
Other Names:
Fonganil;
Fongarid;
Fongaride;
N-(2,6-Dimethylphenyl)-N-(2-furanylcarbonyl)-DL-alanine methyl ester;
Alanine, N-(2-furoyl)-N-(2,6-xylyl), methyl ester, DL-
; more
Formula: C17H19NO4
Class: Pesticides/Herbicides
Furalaxyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 738 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 11/4/2015 10:00:32 AM |
| InChI | InChI=1S/C17H19NO4/c1-11-7-5-8-12(2)15(11)18(13(3)17(20)21-4)16(19)14-9-6-10-22-14/h5-10,13H,1-4H3 |
| InChI Key | CIEXPHRYOLIQQD-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=CC=C1)C)N(C(C)C(=O)OC)C(=O)C2=CC=CO2 |
| CAS | 57646307 |
| Splash | |
| Other Names |
Fonganil; Fongarid; Fongaride; N-(2,6-Dimethylphenyl)-N-(2-furanylcarbonyl)-DL-alanine methyl ester; Alanine, N-(2-furoyl)-N-(2,6-xylyl), methyl ester, DL-; DL-Alanine, N-(2,6-dimethylphenyl)-N-(2-furanylcarbonyl), methyl ester; Methyl N-(2,6-dimethylphenyl)-N-(2-furanylcarbonyl)-DL-alaninate; Methyl N-(2,6-dimethylphenyl)-N-(2-furanylcarbonyl)-DL-alanine; Methyl N-(2,6-dimethylphenyl)-N-(2-furoyl)-DL-alaninate; Methyl N-(2,6-dimethylphenyl)-N-(2-furylcarbonyl)-DL-alaninate; Methyl N-(2,6-dimethylphenyl)-N-(furan-2-ylcarbonyl)alaninate; Methyl N-(2-furoyl)-N-(2,6-xylyl)-DL-alaninate |
| Wikipedia | Furalaxyl (DE) |
| KEGG | C10941 |
| ChemIDPlus | 057646307 |
| PubChem | 42504 |
| ChemSpider | 38763 |
| ChEBI | CHEBI:82787 |