Systematic / IUPAC Name: 1-(Carboxymethyl)cyclohexane-1-carboxylic acid
ID: Reference3231
Other Names:
Gabapentin related compound E;
1-Carboxycyclohexaneacetic acid;
Cyclohexaneacetic acid, 1-carboxy-
Formula: C9H14O4
1-(Carboxymethyl)cyclohexanecarboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 116 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/4/2015 12:40:34 PM |
| InChI | InChI=1S/C9H14O4/c10-7(11)6-9(8(12)13)4-2-1-3-5-9/h1-6H2,(H,10,11)(H,12,13) |
| InChI Key | SDAXMMUAZRUWNL-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)(CC(=O)O)C(=O)O |
| CAS | 67950952 |
| Splash | |
| Other Names |
Gabapentin related compound E; 1-Carboxycyclohexaneacetic acid; Cyclohexaneacetic acid, 1-carboxy- |
| PubChem | 260003 |
| ChEMBL | CHEMBL1487140 |
| ChemSpider | 228197 |