Systematic / IUPAC Name: (1R)-1-Phenylpropane-1,3-diol
ID: Reference3233
Other Names:
(R)-(+)-1-Phenyl-1,3-propanediol;
(R)-3-Phenyl-1,3-dihydroxypropane;
1,3-Propanediol,1-phenyl-, (1R)-
Formula: C9H12O2
(R)-1-Phenyl-1,3-propanediol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 65 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | APCI |
| Analyzers | FT |
| Last Modification | 11/4/2015 12:00:38 PM |
| InChI | InChI=1S/C9H12O2/c10-7-6-9(11)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2/t9-/m1/s1 |
| InChI Key | RRVFYOSEKOTFOG-SECBINFHSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(CCO)O |
| CAS | 103548169 |
| Splash | |
| Other Names |
(R)-(+)-1-Phenyl-1,3-propanediol; (R)-3-Phenyl-1,3-dihydroxypropane; 1,3-Propanediol,1-phenyl-, (1R)- |