Systematic / IUPAC Name: Tris(4-methylphenyl)phosphine
ID: Reference3236
Other Names:
Phosphine, tri-p-tolyl-;
Phosphine, tris(p-tolyl)-;
Phosphorus, tri-p-tolyl;
tri-p-Tolylphosphine ;
tri-p-Tolylphosphane
; more
Formula: C21H21P
Tris(4-tolyl)phosphine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/4/2015 1:59:19 PM |
| InChI | InChI=1S/C21H21P/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21/h4-15H,1-3H3 |
| InChI Key | WXAZIUYTQHYBFW-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)P(C2=CC=C(C=C2)C)C3=CC=C(C=C3)C |
| CAS | 1038955 |
| Splash | |
| Other Names |
Phosphine, tri-p-tolyl-; Phosphine, tris(p-tolyl)-; Phosphorus, tri-p-tolyl; tri-p-Tolylphosphine ; tri-p-Tolylphosphane; Tris(p-tolyl)phosphine; Phosphine, tris(4-methylphenyl)-; Tris(p-methylphenyl)phosphine |
| ChemIDPlus | 001038955 |
| PubChem | 13956 |
| ChemSpider | 13352 |
| ChEMBL | CHEMBL1999292 |