Systematic / IUPAC Name: (E)-3-(3,4-Difluorophenyl)prop-2-enoic acid
ID: Reference3239
Other Names: (2E)-3-(3,4-Difluorophenyl)acrylic acid
Formula: C9H6F2O2
trans-3,4-Difluorocinnamic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/5/2015 6:51:20 AM |
| InChI | InChI=1S/C9H6F2O2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+ |
| InChI Key | HXBOHZQZTWAEHJ-DUXPYHPUSA-N |
| Canonical SMILES | C1=CC(=C(C=C1C=CC(=O)O)F)F |
| CAS | 112897979 |
| Splash | |
| Other Names | (2E)-3-(3,4-Difluorophenyl)acrylic acid |