Systematic / IUPAC Name: 2-(4-{[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]oxy}phenoxy)propanoic acid
ID: Reference3240
Other Names:
2-[4-(3-Chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy]propionic acid;
2-{4-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy}propanoic acid ;
Propanoic acid, 2-(4-{[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy}phenoxy)-
Formula: C15H11ClF3NO4
Class: Pesticides/Herbicides
Haloxyfop mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 134 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/5/2015 6:55:32 AM |
| InChI | InChI=1S/C15H11ClF3NO4/c1-8(14(21)22)23-10-2-4-11(5-3-10)24-13-12(16)6-9(7-20-13)15(17,18)19/h2-8H,1H3,(H,21,22) |
| InChI Key | GOCUAJYOYBLQRH-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(=O)O)OC1=CC=C(C=C1)OC2=C(C=C(C=N2)C(F)(F)F)Cl |
| CAS | 69806344 |
| Splash | |
| Other Names |
2-[4-(3-Chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy]propionic acid; 2-{4-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy}propanoic acid ; Propanoic acid, 2-(4-{[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy}phenoxy)- |