Systematic / IUPAC Name: 1,4-Dichlorophthalazine
ID: Reference3251
Other Names:
1,4-Dichloro-2,3-benzodiazine;
Phthalazine, 1,4-dichloro-
Formula: C8H4Cl2N2
1,4-Dichlorophthalazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/5/2015 10:57:34 AM |
| InChI | InChI=1S/C8H4Cl2N2/c9-7-5-3-1-2-4-6(5)8(10)12-11-7/h1-4H |
| InChI Key | ODCNAEMHGMYADO-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=NN=C2Cl)Cl |
| CAS | 4752107 |
| Splash | |
| Other Names |
1,4-Dichloro-2,3-benzodiazine; Phthalazine, 1,4-dichloro- |
| ChemIDPlus | 004752107 |
| ChEMBL | CHEMBL3185198 |
| PubChem | 78490 |
| ChemSpider | 70855 |