Systematic / IUPAC Name: Methyl 4-methoxy-1H-indole-2-carboxylate
ID: Reference3274
Other Names:
1H-Indole-2-carboxylic acid, 4-methoxy-, methyl ester;
4-Methoxy-1H-indole-2-carboxylic acid methyl ester;
4-Methoxyindole-2-carboxylic acid methyl ester;
Methyl 4-methoxy-2-indolecarboxylate;
Methyl 4-methoxyindole-2-carboxylate
Formula: C11H11NO3
Methyl 4-methoxy-1H-indole-2-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 236 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/6/2015 2:28:15 PM |
| InChI | InChI=1S/C11H11NO3/c1-14-10-5-3-4-8-7(10)6-9(12-8)11(13)15-2/h3-6,12H,1-2H3 |
| InChI Key | GLCZQTLCVLVFGV-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=CC2=C1C=C(N2)C(=O)OC |
| CAS | 111258232 |
| Splash | |
| Other Names |
1H-Indole-2-carboxylic acid, 4-methoxy-, methyl ester; 4-Methoxy-1H-indole-2-carboxylic acid methyl ester; 4-Methoxyindole-2-carboxylic acid methyl ester; Methyl 4-methoxy-2-indolecarboxylate; Methyl 4-methoxyindole-2-carboxylate |
| ChemSpider | 599655 |
| ChEMBL | CHEMBL3290544 |
| PubChem | 688172 |