Systematic / IUPAC Name: 2-Chloropyridine-3-carboxamide
ID: Reference3280
Other Names:
BR-39181;
2-Chloropyridine-3-carboxylic acid amide ;
3-Pyridinecarboxamide, 2-chloro-
Formula: C6H5ClN2O
2-Chloronicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/9/2015 8:12:10 AM |
| InChI | InChI=1S/C6H5ClN2O/c7-5-4(6(8)10)2-1-3-9-5/h1-3H,(H2,8,10) |
| InChI Key | ZQZAHPFFZWEUCL-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(N=C1)Cl)C(=O)N |
| CAS | 10366355 |
| Splash | |
| Other Names |
BR-39181; 2-Chloropyridine-3-carboxylic acid amide ; 3-Pyridinecarboxamide, 2-chloro- |