Systematic / IUPAC Name: Ethyl 2-amino-1-cyclohexene-1-carboxylate
ID: Reference3287
Other Names:
2-Amino-1-cyclohexenecarboxylic acid ethyl ester;
2-Aminocyclohex-1-enecarboxylic acid ethyl ester;
Ethyl 2-aminocyclohex-1-ene-1-carboxylate;
Ethyl 2-aminocyclohex-1-enecarboxylate
Formula: C9H15NO2
Ethyl-2-amino-1-cyclohexene-1-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/9/2015 11:13:42 AM |
| InChI | InChI=1S/C9H15NO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h2-6,10H2,1H3 |
| InChI Key | JBZVWABPSHNPIK-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=C(CCCC1)N |
| CAS | 1128003 |
| Splash | |
| Other Names |
2-Amino-1-cyclohexenecarboxylic acid ethyl ester; 2-Aminocyclohex-1-enecarboxylic acid ethyl ester; Ethyl 2-aminocyclohex-1-ene-1-carboxylate; Ethyl 2-aminocyclohex-1-enecarboxylate |