Systematic / IUPAC Name: Ethyl decanoate
ID: Reference3290
Other Names:
n-Capric acid ethyl ester;
Capric acid ethyl ester;
Decanoic acid ethyl ester;
Ethyl n-decanoate;
Ethyl caprinate
Formula: C12H24O2
Class: Endogenous Metabolites Excipients/Additives/Colorants
Ethyl caprate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 452 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 4/21/2017 6:50:24 AM |
| InChI | InChI=1S/C12H24O2/c1-3-5-6-7-8-9-10-11-12(13)14-4-2/h3-11H2,1-2H3 |
| InChI Key | RGXWDWUGBIJHDO-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCCC(=O)OCC |
| CAS | 110383 |
| Splash | |
| Other Names |
n-Capric acid ethyl ester; Capric acid ethyl ester; Decanoic acid ethyl ester; Ethyl n-decanoate; Ethyl caprinate; Ethyl decylate |
| PubChem | 8048 |
| Wikipedia | Ethyl_decanoate |
| ChEMBL | CHEMBL3184829 |
| ChemIDPlus | 000110383 |
| HMDb | HMDB30998 |
| ChemSpider | 7757 |