Systematic / IUPAC Name: 2-Aminooctanedioic acid
ID: Reference3297
Other Names:
DL-α-Aminosuberic acid;
DL-2-Aminoctanedioic acid;
DL-2-Aminosuberic acid;
Octanedioic acid, 2-amino-
Formula: C8H15NO4
2-Aminooctanedioic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 191 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/22/2018 8:07:13 AM |
| InChI | InChI=1S/C8H15NO4/c9-6(8(12)13)4-2-1-3-5-7(10)11/h6H,1-5,9H2,(H,10,11)(H,12,13) |
| InChI Key | YOFPFYYTUIARDI-UHFFFAOYSA-N |
| Canonical SMILES | C(CCC(C(=O)O)N)CCC(=O)O |
| CAS | |
| Splash | |
| Other Names |
DL-α-Aminosuberic acid; DL-2-Aminoctanedioic acid; DL-2-Aminosuberic acid; Octanedioic acid, 2-amino- |
| ChEMBL | CHEMBL320957 |
| ChemIDPlus | 004254880 |
| PubChem | 77937 |
| ChemSpider | 70327 |