Systematic / IUPAC Name: 2-(3,5-Difluorophenyl)acetic acid
ID: Reference3303
Other Names:
BR-32749;
(3,5-Difluorophenyl)acetic acid;
3,5-Difluorobenzeneacetic acid
Formula: C8H6F2O2
3,5-Difluorophenylacetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 111 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/10/2015 9:01:33 AM |
| InChI | InChI=1S/C8H6F2O2/c9-6-1-5(3-8(11)12)2-7(10)4-6/h1-2,4H,3H2,(H,11,12) |
| InChI Key | IGGNSAVLXJKCNH-UHFFFAOYSA-N |
| Canonical SMILES | C1=C(C=C(C=C1F)F)CC(=O)O |
| CAS | 105184381 |
| Splash | |
| Other Names |
BR-32749; (3,5-Difluorophenyl)acetic acid; 3,5-Difluorobenzeneacetic acid |