Systematic / IUPAC Name: Azelaic acid
ID: Reference331
Other Names:
Nonanedioic acid;
1,7-Heptanedicarboxylic acid;
Heptanedicarboxylic acid;
1,9-Nonanedioic acid;
n-Nonanedioic acid
; more
Formula: C9H16O4
Class: Endogenous Metabolites Excipients/Additives/Colorants Industrial Chemicals
Azelaic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 604 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/11/2016 8:39:15 AM |
| InChI | InChI=1S/C9H16O4/c10-8(11)6-4-2-1-3-5-7-9(12)13/h1-7H2,(H,10,11)(H,12,13) |
| InChI Key | BDJRBEYXGGNYIS-UHFFFAOYSA-N |
| Canonical SMILES | C(CCCC(=O)O)CCCC(=O)O |
| CAS | 123999 |
| Splash | |
| Other Names |
Nonanedioic acid; 1,7-Heptanedicarboxylic acid; Heptanedicarboxylic acid; 1,9-Nonanedioic acid; n-Nonanedioic acid; Azalaic acid; 1,7-Dicarboxyheptane; Finacea; Azelex; Anchoic acid; Skinoren; Lepargylic acid; Finevin; Emerox 1110; Skinorem; Azelainic acid |
| ChEMBL | CHEMBL1238 |
| HMDb | HMDB00784 |
| ChEBI | CHEBI:48131 |
| LipidsMAPs | LMFA01170054 |
| Wikipedia | Azelaic acid |
| ChemSpider | 2179 |
| KEGG | C08261; D03034 |
| DrugBank | APRD00812 |
| ChemIDPlus | 000123999; 068937348; 026776283; 017265133; 017356308; 038900297; 052457542; 068130507; 068130881; 068130892 |
| PubChem | 2266 |