Systematic / IUPAC Name: 2-Cyclopentylacetic acid
ID: Reference3318
Other Names:
(Carboxymethyl)cyclopentane;
Cyclopentaneacetic acid
Formula: C7H12O2
Cyclopentylacetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 73 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/11/2015 9:16:45 AM |
| InChI | InChI=1S/C7H12O2/c8-7(9)5-6-3-1-2-4-6/h6H,1-5H2,(H,8,9) |
| InChI Key | YVHAIVPPUIZFBA-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(C1)CC(=O)O |
| CAS | 1123008 |
| Splash | |
| Other Names |
(Carboxymethyl)cyclopentane; Cyclopentaneacetic acid |