Systematic / IUPAC Name: Quinoline-6-carboxylic acid
ID: Reference3337
Other Names: BR-24770
Formula: C10H7NO2
6-Quinolinecarboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 179 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/12/2015 8:56:02 AM |
| InChI | InChI=1S/C10H7NO2/c12-10(13)8-3-4-9-7(6-8)2-1-5-11-9/h1-6H,(H,12,13) |
| InChI Key | VXGYRCVTBHVXMZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC2=C(C=CC(=C2)C(=O)O)N=C1 |
| CAS | 10349572 |
| Splash | |
| Other Names | BR-24770 |