Systematic / IUPAC Name: (2E)-2-Methyl-2-butenoic acid
ID: Reference3391
Other Names:
E-Tiglate;
E-Tiglic acid;
Cevadic acid;
Tiglate;
Tiglic acid, (E)-
; more
Formula: C5H8O2
Class: Endogenous Metabolites Personal Care Products/Cosmetics Excipients/Additives/Colorants
Tiglic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 97 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/19/2015 2:20:27 PM |
| InChI | InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7)/b4-3+ |
| InChI Key | UIERETOOQGIECD-ONEGZZNKSA-N |
| Canonical SMILES | CC=C(C)C(=O)O |
| CAS | 80591 |
| Splash | |
| Other Names |
E-Tiglate; E-Tiglic acid; Cevadic acid; Tiglate; Tiglic acid, (E)-; Tiglinic acid; α-Methylcrotonic acid; α-Methylcrotonic acid, (E)-; (E)-2,3-Dimethylacrylic acid; (E)-2-Methyl-2-butenoic acid; (E)-2-Methylbut-2-enoic acid; (E)-2-Methylcrotonic acid; (2E)-2-Methylbut-2-enoic acid; trans-α,β-Dimethylacrylic acid; trans-2,3-Dimethylacrylic acid; trans-2-Methyl-2-butenoic acid; trans-2-Methylcrotonic acid; trans-Crotonic acid, 2-methyl-; 2,3-Dimethylacrylic acid; 2,3-Dimethylacrylic acid, (E)-; 2-Butenoic acid, 2-methyl-, (E)-; 2-Butenoic acid, 2-methyl-, (2E)-; 2-Methyl-(E)-2-butenoic acid; 2-Methyl-2E-butenoic acid; 2-Methyl-2-butenoate; 2-Methyl-2-butenoic acid, (E)-; 2-Methylcrotonic acid; Methylmethacrylic acid |
| ChEBI | CHEBI:9592 |
| KEGG | C08279 |
| HMDb | HMDB01470 |
| Wikipedia | Tiglic acid |
| ChemSpider | 111629 |
| PubChem | 125468 |
| ChemIDPlus | 000080591; 013201462 |
| LipidsMAPs | LMFA01020030 |