Systematic / IUPAC Name: 3,4-Dihydroxybenzaldehyde
ID: Reference3393
Other Names:
BR-39223;
Protocatechualdehyde;
Protocatechuic aldehyde;
Rancinamycin IV;
1,2-Dihydroxy-4-formylbenzene
; more
Formula: C7H6O3
Class: Endogenous Metabolites Excipients/Additives/Colorants Therapeutics/Prescription Drugs
3,4-Dihydroxybenzaldehyde mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 294 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/19/2015 3:20:35 PM |
| InChI | InChI=1S/C7H6O3/c8-4-5-1-2-6(9)7(10)3-5/h1-4,9-10H |
| InChI Key | IBGBGRVKPALMCQ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1C=O)O)O |
| CAS | 139855 |
| Splash | |
| Other Names |
BR-39223; Protocatechualdehyde; Protocatechuic aldehyde; Rancinamycin IV; 1,2-Dihydroxy-4-formylbenzene; 3,4-Dihydroxy benzaldehyde; 3,4-Dihydroxybenzenecarbonal; 3,4-Dihydroxybenzyl aldehyde; 4-Formyl-1,2-benzenediol; 4-Formyl-1,2-dihydroxybenzene; 4-Formylbenzene-1,2-diol; 4-Formylcatechol; Benzaldehyde, 3,4-dihydroxy- |
| Wikipedia | Protocatechuic aldehyde |
| ChEBI | CHEBI:50205 |
| ChemIDPlus | 000139855 |
| ChemSpider | 8438 |
| KEGG | C16700 |
| HMDb | HMDB59965 |
| PubChem | 8768 |