Systematic / IUPAC Name: 1-(4-Chlorobenzyl)-1-cyclopentyl-3-phenylurea
ID: Reference3413
Other Names:
Trotis;
[(Chlorophenyl)-methyl]-N-cyclopentyl-N'-phenylurea ;
N-[(4-Chlorophenyl)methyl]-N-cyclopentyl-N'-phenylurea ;
1-[(4-Chlorophenyl)methyl]-1-cyclopentyl-3-phenylurea ;
1-(p-Chlorobenzyl)-1-cyclopentyl-3-phenylurea
; more
Formula: C19H21ClN2O
Class: Pesticides/Herbicides
Pencycuron mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 1750 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 3/17/2016 1:15:37 PM |
| InChI | InChI=1S/C19H21ClN2O/c20-16-12-10-15(11-13-16)14-22(18-8-4-5-9-18)19(23)21-17-6-2-1-3-7-17/h1-3,6-7,10-13,18H,4-5,8-9,14H2,(H,21,23) |
| InChI Key | OGYFATSSENRIKG-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(C1)N(CC2=CC=C(C=C2)Cl)C(=O)NC3=CC=CC=C3 |
| CAS | 66063056 |
| Splash | |
| Other Names |
Trotis; [(Chlorophenyl)-methyl]-N-cyclopentyl-N'-phenylurea ; N-[(4-Chlorophenyl)methyl]-N-cyclopentyl-N'-phenylurea ; 1-[(4-Chlorophenyl)methyl]-1-cyclopentyl-3-phenylurea ; 1-(p-Chlorobenzyl)-1-cyclopentyl-3-phenylurea; 1-[(4-Chlorophenyl)methyl]-1-cyclopentyl-3-phenylurea; Urea, N-[(4-chlorophenyl)methyl]-N-cyclopentyl-N'-phenyl- Urea, N-[(4-chlorophenyl)methyl]-N-cyclopentyl-N'-phenyl- |
| ChEBI | CHEBI:7957 |
| PubChem | 91692 |
| KEGG | C11012 |
| ChEMBL | CHEMBL2229452 |
| Wikipedia | Pencycuron |
| ChemSpider | 82795 |
| ChemIDPlus | 066063056 |