Systematic / IUPAC Name: 2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid
ID: Reference342
Other Names: ß-Alanyl-L-histidine
Formula: C9H14N4O3
Class: Endogenous Metabolites
Carnosine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 312 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/19/2014 9:08:45 AM |
| InChI | InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16) |
| InChI Key | CQOVPNPJLQNMDC-UHFFFAOYSA-N |
| Canonical SMILES | C1=C(N=CN1)CC(C(=O)O)NC(=O)CCN |
| CAS | 305840 |
| Splash | |
| Other Names | ß-Alanyl-L-histidine |