Systematic / IUPAC Name: N-(4-Fluorophenyl)-6-[4-(trifluoromethyl)phenoxy]pyridine-2-carboxamide
ID: Reference3421
Other Names: 2-Pyridinecarboxamide, N-(4-fluorophenyl)-6-[4-(trifluoromethyl)phenoxy]-
Formula: C19H12F4N2O2
Class: Pesticides/Herbicides
Picolinafen mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 57 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/25/2015 1:39:35 PM |
| InChI | InChI=1S/C19H12F4N2O2/c20-13-6-8-14(9-7-13)24-18(26)16-2-1-3-17(25-16)27-15-10-4-12(5-11-15)19(21,22)23/h1-11H,(H,24,26) |
| InChI Key | PGSPTHKIIXXDND-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=NC(=C1)OC2=CC=C(C=C2)C(F)(F)F)C(=O)NC3=CC=C(C=C3)F |
| CAS | 137641055 |
| Splash | |
| Other Names | 2-Pyridinecarboxamide, N-(4-fluorophenyl)-6-[4-(trifluoromethyl)phenoxy]- |
| PubChem | 11534636 |
| ChemSpider | 9709419 |
| Wikipedia | Picolinafen |