Systematic / IUPAC Name: Pyrrolidine-2-carboxamide
ID: Reference3432
Other Names:
(S)-2-Pyrrolidinecarboxamide;
2-Pyrrolidinecarboxamide;
Pyrrolidine-2-carboxylic acid amide
Formula: C5H10N2O
Prolinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 63 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/27/2015 7:40:23 AM |
| InChI | InChI=1S/C5H10N2O/c6-5(8)4-2-1-3-7-4/h4,7H,1-3H2,(H2,6,8) |
| InChI Key | VLJNHYLEOZPXFW-UHFFFAOYSA-N |
| Canonical SMILES | C1CC(NC1)C(=O)N |
| CAS | |
| Splash | |
| Other Names |
(S)-2-Pyrrolidinecarboxamide; 2-Pyrrolidinecarboxamide; Pyrrolidine-2-carboxylic acid amide |
| ChemSpider | 479142 |
| KEGG | C19781 |
| PubChem | 550774 |
| ChEMBL | CHEMBL1599880 |