Systematic / IUPAC Name: 2-(1-Chlorocyclopropyl)-1-(2-chlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol
ID: Reference3438
Other Names:
α-(1-Chlorocyclopropyl)-α-[(2-chlorophenyl)methyl]-1H-1,2,4-triazole-1-ethanol ;
1H-1,2,4-Triazole-1-ethanol, α-(1-chlorocyclopropyl)-α-[(2-chlorophenyl)methyl]- ;
2-(1-Chlorocyclopropyl)-1-(2-chlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propan-2-ol
Formula: C14H15Cl2N3O
Class: Pesticides/Herbicides
Prothioconazole-desthio mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1135 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 11/27/2015 1:08:28 PM |
| InChI | InChI=1S/C14H15Cl2N3O/c15-12-4-2-1-3-11(12)7-14(20,13(16)5-6-13)8-19-10-17-9-18-19/h1-4,9-10,20H,5-8H2 |
| InChI Key | HHUQPWODPBDTLI-UHFFFAOYSA-N |
| Canonical SMILES | C1CC1(C(CC2=CC=CC=C2Cl)(CN3C=NC=N3)O)Cl |
| CAS | 120983644 |
| Splash | |
| Other Names |
α-(1-Chlorocyclopropyl)-α-[(2-chlorophenyl)methyl]-1H-1,2,4-triazole-1-ethanol ; 1H-1,2,4-Triazole-1-ethanol, α-(1-chlorocyclopropyl)-α-[(2-chlorophenyl)methyl]- ; 2-(1-Chlorocyclopropyl)-1-(2-chlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propan-2-ol |
| ChEMBL | CHEMBL2288018 |
| ChemSpider | 106612 |
| ChemIDPlus | 120983644 |
| PubChem | 119361 |