Systematic / IUPAC Name: 7-Chloro-3-methyl-8-quinolinecarboxylic acid
ID: Reference3442
Other Names:
Fiesta;
7-Chloro-3-methylquinoline-8-carboxylic acid;
8-Quinolinecarboxylic acid, 7-chloro-3-methyl-
Formula: C11H8ClNO2
Class: Pesticides/Herbicides
Quinmerac mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 67 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/30/2015 8:26:52 AM |
| InChI | InChI=1S/C11H8ClNO2/c1-6-4-7-2-3-8(12)9(11(14)15)10(7)13-5-6/h2-5H,1H3,(H,14,15) |
| InChI Key | ALZOLUNSQWINIR-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CN=C2C(=C1)C=CC(=C2C(=O)O)Cl |
| CAS | 90717036 |
| Splash | |
| Other Names |
Fiesta; 7-Chloro-3-methylquinoline-8-carboxylic acid; 8-Quinolinecarboxylic acid, 7-chloro-3-methyl- |