Systematic / IUPAC Name: (2Z,4Z)-2,4-Hexadienedioic acid
ID: Reference346
Other Names:
cis,cis-Muconate;
(2Z,4Z)-Hexa-2,4-dienedioic acid;
cis,cis-2,4-Hexadienedioic acid;
cis,cis-Hexadienedioate;
(Z,Z)-2,4-Hexadienedioic acid
; more
Formula: C6H6O4
Class: Endogenous Metabolites
cis,cis-Muconic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 481 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/19/2014 12:00:17 PM |
| InChI | InChI=1S/C6H6O4/c7-5(8)3-1-2-4-6(9)10/h1-4H,(H,7,8)(H,9,10)/b3-1-,4-2- |
| InChI Key | TXXHDPDFNKHHGW-CCAGOZQPSA-N |
| Canonical SMILES | C(=C\C(=O)O)\C=C/C(=O)O |
| CAS | 1119728 |
| Splash | |
| Other Names |
cis,cis-Muconate; (2Z,4Z)-Hexa-2,4-dienedioic acid; cis,cis-2,4-Hexadienedioic acid; cis,cis-Hexadienedioate; (Z,Z)-2,4-Hexadienedioic acid; 2,4-Hexadienedioic acid, (Z,Z)-; 2Z,4Z-Hexadienedioic acid; cis-cis-Hexadienedioic acid; (Z,Z)-2,4-Hexadienedioate |
| ChEBI | CHEBI:16508 |
| KEGG | C02480 |
| ChemIDPlus | 001119728 |
| ChemSpider | 4444151 |
| Wikipedia | Muconic acid |
| HMDb | HMDB06331 |
| PubChem | 5280518 |