Systematic / IUPAC Name: 3,5-Dihydroxy-4-[3-(4-hydroxyphenyl)propanoyl]phenyl 2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside
ID: Reference3479
Other Names: 1-Propanone, 1-(4{[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy}-2,6-dihydroxyphenyl)-3-(4-hydroxyphenyl)-
Formula: C27H34O14
Class: Endogenous Metabolites Excipients/Additives/Colorants
Naringin dihydrochalcone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 12864 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7, MS8 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 12/10/2015 8:43:26 AM |
| InChI | InChI=1S/C27H34O14/c1-11-20(33)22(35)24(37)26(38-11)41-25-23(36)21(34)18(10-28)40-27(25)39-14-8-16(31)19(17(32)9-14)15(30)7-4-12-2-5-13(29)6-3-12/h2-3,5-6,8-9,11,18,20-29,31-37H,4,7,10H2,1H3/t11-,18+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1 |
| InChI Key | CWBZAESOUBENAP-QVNVHUMTSA-N |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC(=C(C(=C3)O)C(=O)CCC4=CC=C(C=C4)O)O)CO)O)O)O)O)O |
| CAS | 18916171 |
| Splash | |
| Other Names | 1-Propanone, 1-(4{[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy}-2,6-dihydroxyphenyl)-3-(4-hydroxyphenyl)- |
| Wikipedia | Naringin dihydrochalcone |
| ChemSpider | 8070254 |
| PubChem | 9894584 |