Systematic / IUPAC Name: (2E)-3-(3-Methoxyphenyl)acrylic acid
ID: Reference3482
Other Names:
(E)-3-(3-Methoxyphenyl)acrylic acid;
(E)-3-(3-Methoxyphenyl)prop-2-enoic acid;
(2E)-3-(3-Methoxyphenyl)prop-2-enoic acid;
trans-3-(3-Methoxyphenyl)acrylic acid;
trans-3-Methoxycinnamic acid
; more
Formula: C10H10O3
Class: Endogenous Metabolites
3-Methoxycinnamic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 195 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 12/15/2015 6:52:28 AM |
| InChI | InChI=1S/C10H10O3/c1-13-9-4-2-3-8(7-9)5-6-10(11)12/h2-7H,1H3,(H,11,12)/b6-5+ |
| InChI Key | LZPNXAULYJPXEH-AATRIKPKSA-N |
| Canonical SMILES | COC1=CC=CC(=C1)C=CC(=O)O |
| CAS | 6099043 |
| Splash | |
| Other Names |
(E)-3-(3-Methoxyphenyl)acrylic acid; (E)-3-(3-Methoxyphenyl)prop-2-enoic acid; (2E)-3-(3-Methoxyphenyl)prop-2-enoic acid; trans-3-(3-Methoxyphenyl)acrylic acid; trans-3-Methoxycinnamic acid; 2-Propenoic acid, 3-(3-methoxyphenyl)-; 2-Propenoic acid, 3-(3-methoxyphenyl)-, (2E)-; 3-(3-Methoxyphenyl)prop-2-enoic acid; 3-Methoxycinnamicacid; Cinnamic acid, m-methoxy-; Cinnamic acid, 3-methoxy-; Propenoic acid, 3-(3-methoxyphenyl)-, trans- |
| ChemSpider | 553269 |
| PubChem | 637668 |
| ChemIDPlus | 017570262; 006099043 |
| ChEMBL | CHEMBL95769 |