Systematic / IUPAC Name: 5-Ethyl-2-(5-{[4-(2-hydroxyethyl)-1-piperazinyl]sulfonyl}-2-propoxyphenyl)-7-propyl-1,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one
ID: Reference3510
Other Names: 4H-Pyrrolo[3,2-d]pyrimidin-4-one, 5-ethyl-1,5-dihydro-2-(5-{[4-(2-hydroxyethyl)-1-piperazinyl]sulfonyl}-2-propoxyphenyl)-7-propyl-
Formula: C26H37N5O5S
Class: Therapeutics/Prescription Drugs
Mirodenafil mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/18/2015 10:00:44 AM |
| InChI | InChI=1S/C26H37N5O5S/c1-4-7-19-18-30(6-3)24-23(19)27-25(28-26(24)33)21-17-20(8-9-22(21)36-16-5-2)37(34,35)31-12-10-29(11-13-31)14-15-32/h8-9,17-18,32H,4-7,10-16H2,1-3H3,(H,27,28,33) |
| InChI Key | MIJFNYMSCFYZNY-UHFFFAOYSA-N |
| Canonical SMILES | CCCC1=CN(C2=C1NC(=NC2=O)C3=C(C=CC(=C3)S(=O)(=O)N4CCN(CC4)CCO)OCCC)CC |
| CAS | 862189955 |
| Splash | |
| Other Names | 4H-Pyrrolo[3,2-d]pyrimidin-4-one, 5-ethyl-1,5-dihydro-2-(5-{[4-(2-hydroxyethyl)-1-piperazinyl]sulfonyl}-2-propoxyphenyl)-7-propyl- |
| ChemSpider | 10173481 |
| Wikipedia | Mirodenafil |
| PubChem | 12001014 |