Systematic / IUPAC Name: 2-Chloro-N-[(1,1-dioxido-1-benzothiophen-6-yl)carbamoyl]benzamide
ID: Reference3518
Other Names:
Formula: C16H11ClN2O4S
N-(2-Chlorobenzoyl)-N'-(1,1-dioxo-1H-1λ6-benzo[b]thiophen-6-yl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 503 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 1/18/2016 10:01:08 AM |
| InChI | InChI=1S/C16H11ClN2O4S/c17-13-4-2-1-3-12(13)15(20)19-16(21)18-11-6-5-10-7-8-24(22,23)14(10)9-11/h1-9H,(H2,18,19,20,21) |
| InChI Key | GKADZDQTJJUSFA-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)NC(=O)NC2=CC3=C(C=C2)C=CS3(=O)=O)Cl |
| CAS | |
| Splash | |
| Other Names |