Systematic / IUPAC Name: 4-Methyl-N-(2-{2-[(4-methylphenyl)sulfonyl]hydrazino}-2-oxoethyl)-2-thiophenecarboxamide
ID: Reference3523
Other Names:
Formula: C15H17N3O4S2
N-2-(2-{2-[(4-Methylphenyl)sulfonyl]hydrazino}-2-oxoethyl)-4-methylthiophene-2-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 420 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 1/11/2016 8:19:08 AM |
| InChI | InChI=1S/C15H17N3O4S2/c1-10-3-5-12(6-4-10)24(21,22)18-17-14(19)8-16-15(20)13-7-11(2)9-23-13/h3-7,9,18H,8H2,1-2H3,(H,16,20)(H,17,19) |
| InChI Key | XNAQOXNEMAXNDQ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)NNC(=O)CNC(=O)C2=CC(=CS2)C |
| CAS | |
| Splash | |
| Other Names |