Systematic / IUPAC Name: 2-[(2E)-2-(2,3-Dimethoxybenzylidene)hydrazino]-3-nitropyridine
ID: Reference3524
Other Names:
Formula: C14H14N4O4
2,3-Dimethoxybenzaldehyde 1-(3-nitro-2-pyridyl)hydrazone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1043 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 1/11/2016 8:21:44 AM |
| InChI | InChI=1S/C14H14N4O4/c1-21-12-7-3-5-10(13(12)22-2)9-16-17-14-11(18(19)20)6-4-8-15-14/h3-9H,1-2H3,(H,15,17)/b16-9+ |
| InChI Key | GRCYQIMUVPKNDJ-CXUHLZMHSA-N |
| Canonical SMILES | COC1=CC=CC(=C1OC)C=NNC2=C(C=CC=N2)[N+](=O)[O-] |
| CAS | |
| Splash | |
| Other Names |
| ChemSpider | 7854772 |
| PubChem | 9580624 |
| ChEMBL | CHEMBL1986514 |