Systematic / IUPAC Name: Ethyl 4-acetamido-3-phenyl-2-thioxo-2,3-dihydro-1,3-thiazole-5-carboxylate
ID: Reference3526
Other Names:
Formula: C14H14N2O3S2
Ethyl 4-(acetylamino)-3-phenyl-2-thioxo-2,3-dihydro-1,3-thiazole-5-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2885 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 1/11/2016 8:27:05 AM |
| InChI | InChI=1S/C14H14N2O3S2/c1-3-19-13(18)11-12(15-9(2)17)16(14(20)21-11)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3,(H,15,17) |
| InChI Key | NFYVPDIMLJWDQL-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=C(N(C(=S)S1)C2=CC=CC=C2)NC(=O)C |
| CAS | |
| Splash | |
| Other Names |
| ChEMBL | CHEMBL1362981 |
| ChemSpider | 2092131 |
| PubChem | 2813732 |