Systematic / IUPAC Name: 1-[(5-Nitro-2-pyrrolidin-1-ylphenyl)methyl]imidazole
ID: Reference3527
Other Names:
Formula: C14H16N4O2
1-[5-Nitro-2-(1-pyrrolidinyl)benzyl]-1H-imidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1490 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 1/18/2016 9:59:25 AM |
| InChI | InChI=1S/C14H16N4O2/c19-18(20)13-3-4-14(17-6-1-2-7-17)12(9-13)10-16-8-5-15-11-16/h3-5,8-9,11H,1-2,6-7,10H2 |
| InChI Key | DYCNPDHQBILIME-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |