Systematic / IUPAC Name: 3-Methoxy-1-({5-[(2-oxo-2-phenylethyl)sulfanyl]-1,3,4-oxadiazol-2-yl}methyl)-2(1H)-pyridinone
ID: Reference3549
Other Names: 3-Methoxy-1-({5-[(2-oxo-2-phenylethyl)sulfanyl]-1,3,4-oxadiazol-2-yl}methyl)-1,2-dihydropyridin-2-one
Formula: C17H15N3O4S
3-Methoxy-1-({5-[(2-oxo-2-phenylethyl)thio]-1,3,4-oxadiazol-2-yl}methyl)-1,2-dihydropyridin-2-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 2267 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/12/2016 11:23:22 AM |
| InChI | InChI=1S/C17H15N3O4S/c1-23-14-8-5-9-20(16(14)22)10-15-18-19-17(24-15)25-11-13(21)12-6-3-2-4-7-12/h2-9H,10-11H2,1H3 |
| InChI Key | NZBJLKAEDDXIOL-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=CN(C1=O)CC2=NN=C(O2)SCC(=O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 3-Methoxy-1-({5-[(2-oxo-2-phenylethyl)sulfanyl]-1,3,4-oxadiazol-2-yl}methyl)-1,2-dihydropyridin-2-one |