Systematic / IUPAC Name: Diphenyl 2-fluorobenzene-1,3-dicarboxylate
ID: Reference3555
Other Names: 1,3-Benzenedicarboxylic acid, 2-fluoro-, diphenyl ester
Formula: C20H13FO4
Diphenyl 2-fluoroisophthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 359 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/12/2016 1:24:44 PM |
| InChI | InChI=1S/C20H13FO4/c21-18-16(19(22)24-14-8-3-1-4-9-14)12-7-13-17(18)20(23)25-15-10-5-2-6-11-15/h1-13H |
| InChI Key | WVTIWLYDIVQAJU-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)OC(=O)C2=C(C(=CC=C2)C(=O)OC3=CC=CC=C3)F |
| CAS | |
| Splash | |
| Other Names | 1,3-Benzenedicarboxylic acid, 2-fluoro-, diphenyl ester |