Systematic / IUPAC Name: [4-(Diphenylmethyl)-1-piperazinyl](5-phenyl-1,3,4-oxadiazol-2-yl)methanone
ID: Reference3558
Other Names:
Formula: C26H24N4O2
(4-Benzhydrylpiperazino)(5-phenyl-1,3,4-oxadiazol-2-yl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 259 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/12/2016 1:51:16 PM |
| InChI | InChI=1S/C26H24N4O2/c31-26(25-28-27-24(32-25)22-14-8-3-9-15-22)30-18-16-29(17-19-30)23(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-15,23H,16-19H2 |
| InChI Key | LKYCGZFZXHQEQN-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCN1C(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)C4=NN=C(O4)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names |