Systematic / IUPAC Name: 2,6-Difluoro-N-[2-({[5-(2-thienyl)-1,2,4-oxadiazol-3-yl]methyl}sulfanyl)phenyl]benzamide
ID: Reference3567
Other Names:
Formula: C20H13F2N3O2S2
2,6-Difluoro-N-[2-({[5-(2-thienyl)-1,2,4-oxadiazol-3-yl]methyl}thio)phenyl]benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 2359 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/13/2016 9:30:42 AM |
| InChI | InChI=1S/C20H13F2N3O2S2/c21-12-5-3-6-13(22)18(12)19(26)23-14-7-1-2-8-15(14)29-11-17-24-20(27-25-17)16-9-4-10-28-16/h1-10H,11H2,(H,23,26) |
| InChI Key | YTRMRQLWOWNKEH-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)NC(=O)C2=C(C=CC=C2F)F)SCC3=NOC(=N3)C4=CC=CS4 |
| CAS | |
| Splash | |
| Other Names |