Systematic / IUPAC Name: N-{2-Chloro-6-[(4-chlorophenyl)sulfanyl]benzyl}acetamide
ID: Reference3629
Other Names: Acetamide, N-({2-chloro-6-[(4-chlorophenyl)thio]phenyl}methyl)-
Formula: C15H13Cl2NOS
N-{2-Chloro-6-[(4-chlorophenyl)thio]benzyl}acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 196 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/18/2016 8:13:40 AM |
| InChI | InChI=1S/C15H13Cl2NOS/c1-10(19)18-9-13-14(17)3-2-4-15(13)20-12-7-5-11(16)6-8-12/h2-8H,9H2,1H3,(H,18,19) |
| InChI Key | BXDQTJOOVZLECZ-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NCC1=C(C=CC=C1Cl)SC2=CC=C(C=C2)Cl |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-({2-chloro-6-[(4-chlorophenyl)thio]phenyl}methyl)- |