Systematic / IUPAC Name: N-Benzyl-2-[(2-oxo-3-piperidinyl)carbonyl]hydrazinecarbothioamide
ID: Reference3631
Other Names: 3-Piperidinecarboxylic acid, 2-oxo, 2-{[(phenylmethyl)amino]thioxomethyl}hydrazide
Formula: C14H18N4O2S
N1-Benzyl-2-[(2-oxo-3-piperidyl)carbonyl]hydrazine-1-carbothioamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 367 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/18/2016 9:31:25 AM |
| InChI | InChI=1S/C14H18N4O2S/c19-12-11(7-4-8-15-12)13(20)17-18-14(21)16-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H,15,19)(H,17,20)(H2,16,18,21) |
| InChI Key | QZMHAFLJEGCPHV-UHFFFAOYSA-N |
| Canonical SMILES | C1CC(C(=O)NC1)C(=O)NNC(=S)NCC2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names | 3-Piperidinecarboxylic acid, 2-oxo, 2-{[(phenylmethyl)amino]thioxomethyl}hydrazide |