Systematic / IUPAC Name: 6-Fluoro-8-[(methylsulfonyl)methyl]-4H-1,3-benzodioxine
ID: Reference3640
Other Names:
Formula: C10H11FO4S
6-Fluoro-8-[(methylsulfonyl)methyl]-4H-1,3-benzodioxine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/26/2016 12:06:56 PM |
| InChI | InChI=1S/C10H11FO4S/c1-16(12,13)5-8-3-9(11)2-7-4-14-6-15-10(7)8/h2-3H,4-6H2,1H3 |
| InChI Key | OIPNTWFUNWPPTA-UHFFFAOYSA-N |
| Canonical SMILES | CS(=O)(=O)CC1=C2C(=CC(=C1)F)COCO2 |
| CAS | |
| Splash | |
| Other Names |