Systematic / IUPAC Name: 7-[(4-Nitrobenzyl)sulfanyl]-5-phenyl[1,2,4]triazolo[1,5-a]pyrimidine
ID: Reference3668
Other Names: [1,2,4]Triazolo[1,5-a]pyrimidine, 7-{[(4-nitrophenyl)methyl]thio}-5-phenyl-
Formula: C18H13N5O2S
7-[(4-Nitrobenzyl)sulfanyl]-5-phenyl[1,2,4]triazolo[1,5-a]pyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/2/2016 8:21:58 AM |
| InChI | InChI=1S/C18H13N5O2S/c24-23(25)15-8-6-13(7-9-15)11-26-17-10-16(14-4-2-1-3-5-14)21-18-19-12-20-22(17)18/h1-10,12H,11H2 |
| InChI Key | QBHNYRWYCQLKBR-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | [1,2,4]Triazolo[1,5-a]pyrimidine, 7-{[(4-nitrophenyl)methyl]thio}-5-phenyl- |