Systematic / IUPAC Name: Dioctyl benzene-1,2-dicarboxylate
ID: Reference37
Other Names:
n-Octyl phthalate;
Phthalic acid di-n-octyl ester;
Bis(n-octyl) phthalate;
Dioctyl 1,2-benzenedicarboxylate;
Dioctyl o-benzenedicarboxylate
; more
Formula: C24H38O4
Class: Extractables/Leachables Textile Chemicals/Auxiliary/Dyes Industrial Chemicals
Dioctyl phthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 488 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 4/2/2019 10:56:49 AM |
| InChI | InChI=1S/C24H38O4/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3 |
| InChI Key | MQIUGAXCHLFZKX-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC |
| CAS | 117840 |
| Splash | |
| Other Names |
n-Octyl phthalate; Phthalic acid di-n-octyl ester; Bis(n-octyl) phthalate; Dioctyl 1,2-benzenedicarboxylate; Dioctyl o-benzenedicarboxylate; Benzenedicarboxylic acid di-n-octyl ester; Benzene-1,2-dicarboxylic acid dioctyl ester; Vinicizer 85; DNOP |
| KEGG | C14227 |
| ChemIDPlus | 000117840 |
| ChemSpider | 8043 |
| Wikipedia | Dioctylphthalat |
| ChEMBL | CHEMBL1409747 |
| PubChem | 8346 |
| WebBook | 5083061 |