Systematic / IUPAC Name: N'-{[(3-Chlorophenyl)carbamoyl]oxy}-1,2-oxazole-5-carboximidamide
ID: Reference3720
Other Names: 5-Isoxazolecarboximidamide, N'-({[(3-chlorophenyl)amino]carbonyl}oxy)-
Formula: C11H9ClN4O3
N'-{[(3-Chloroanilino)carbonyl]oxy}isoxazole-5-carboximidamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 190 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/5/2016 9:56:21 AM |
| InChI | InChI=1S/C11H9ClN4O3/c12-7-2-1-3-8(6-7)15-11(17)19-16-10(13)9-4-5-14-18-9/h1-6H,(H2,13,16)(H,15,17) |
| InChI Key | WXRULVRFRCOVPH-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC(=C1)Cl)NC(=O)ON=C(C2=CC=NO2)N |
| CAS | |
| Splash | |
| Other Names | 5-Isoxazolecarboximidamide, N'-({[(3-chlorophenyl)amino]carbonyl}oxy)- |
| PubChem | 5704034; 9580906 |
| ChEMBL | CHEMBL2164433 |
| ChemSpider | 2026144 |