Systematic / IUPAC Name: 12-(Benzylsulfanyl)phenanthro[9,10-E][1,2,4]triazolo[4,3-b][1,2,4]triazine
ID: Reference3725
Other Names: Phenanthro[9,10-E][1,2,4]triazolo[4,3-b][1,2,4]triazine, 12-[(phenylmethyl)thio]-
Formula: C23H15N5S
12-(Benzylthio)phenanthro[9,10-e][1,2,4]triazolo[4,3-b][1,2,4]triazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/5/2016 12:00:45 PM |
| InChI | InChI=1S/C23H15N5S/c1-2-8-15(9-3-1)14-29-23-26-25-22-24-20-18-12-6-4-10-16(18)17-11-5-7-13-19(17)21(20)27-28(22)23/h1-13H,14H2 |
| InChI Key | XXCHDSRRVGDRAG-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)CSC2=NN=C3N2N=C4C5=CC=CC=C5C6=CC=CC=C6C4=N3 |
| CAS | |
| Splash | |
| Other Names | Phenanthro[9,10-E][1,2,4]triazolo[4,3-b][1,2,4]triazine, 12-[(phenylmethyl)thio]- |