Systematic / IUPAC Name: 2-(3,5-Dichloro-4-pyridinyl)-N-phenylhydrazinecarboxamide
ID: Reference3731
Other Names: Hydrazinecarboxamide, 2-(3,5-dichloro-4-pyridinyl)-N-phenyl-
Formula: C12H10Cl2N4O
N1-Phenyl-2-(3,5-dichloro-4-pyridyl)hydrazine-1-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/5/2016 2:19:04 PM |
| InChI | InChI=1S/C12H10Cl2N4O/c13-9-6-15-7-10(14)11(9)17-18-12(19)16-8-4-2-1-3-5-8/h1-7H,(H,15,17)(H2,16,18,19) |
| InChI Key | BPFPMBZRTPXJFS-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)NC(=O)NNC2=C(C=NC=C2Cl)Cl |
| CAS | |
| Splash | |
| Other Names | Hydrazinecarboxamide, 2-(3,5-dichloro-4-pyridinyl)-N-phenyl- |