Systematic / IUPAC Name: 1-(3-Chloro-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline
ID: Reference3745
Other Names:
Formula: C19H16ClNO2S
1-(3-Chlorobenzo[b]thiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/8/2016 1:01:51 PM |
| InChI | InChI=1S/C19H16ClNO2S/c1-22-14-9-11-7-8-21-18(13(11)10-15(14)23-2)19-17(20)12-5-3-4-6-16(12)24-19/h3-6,9-10H,7-8H2,1-2H3 |
| InChI Key | TVTSHEJXBNJDPZ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C=C2C(=C1)CCN=C2C3=C(C4=CC=CC=C4S3)Cl)OC |
| CAS | |
| Splash | |
| Other Names |